반응 #350337

ord-5e2a734b130f4b8c9de65673851dcfe4

반응 방정식

[Li][CH](C)CC
secondary butyllithium
C=CC(=C)C
isoprene
C=CC(=C)C.C=CC(=C)C.C=Cc1ccccc1
isoprene styrene/isoprene

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타Polymerization

실험 절차

A living poly(isoprene/styrene/isoprene) three block copolymer was prepared by polymerizing isoprene (151.3 g) in cyclohexane (1362 g) solution. Polymerization was initiated by the addition of 79.5 ml of a 95 mmole/liter solution of secondary butyllithium. The reaction was continued for 2.5 hours at 50° C. The living polyisoprene (number average molecular weight 25,600) solution formed was then reacted with styrene (37.9 g) and the reaction was continued for a further 2.5 hours at 50° C. The living poly(isoprene/styrene) block copolymer (number average molecular weight 31,200) solution formed was then reacted with a further amount of isoprene (151.3 g) and the reaction was continued for a further 2.5 hours at 50° C. The number average molecular weight of the living poly(isoprene/styrene/isoprene) block copolymer was 54,400.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US04156673uspto-grants-1979_05