반응 #327390

ord-3efe79017a454dceab2053fce36d7183

반응 방정식

O=C1OC(=O)c2ccccc21
Phthalic anhydride
C=CC(=O)OCCO
2-hydroxyethyl acrylate
C=CC(=O)OCCOC(=O)c1ccccc1C(=O)O
Phthalic Acid mono-(2-acryloyloxy-ethyl) ester

반응 조건

온도
75°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타A small amount of dry air was bubbled into the liquid reaction mixture
  2. 2
    workup.ADDITIONThe reaction mixture was mixed
  3. 3
    온도The product was cooled to room temperature
  4. 4
    기타The product partially crystallized over time
  5. 5
    workup.ADDITIONThe product was mixed with 1-methoxy-2-propanol
  6. 6
    기타to obtain a 50 weight percent solution

실험 절차

Phthalic anhydride (112.1 grams), 2-hydroxyethyl acrylate (87.9 grams), and triethylamine (0.44 grams) were mixed in a round bottom flask. A small amount of dry air was bubbled into the liquid reaction mixture. The reaction mixture was mixed and heated to 75° C. and held at that temperature for six hours. The product was cooled to room temperature. NMR was used to confirm that the product was phthalic acid mono-(2-acryloyloxy-ethyl)ester. The product partially crystallized over time. The product was mixed with 1-methoxy-2-propanol to obtain a 50 weight percent solution.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08647510B2uspto-grants-2014_02