반응 #315786

ord-13c65d061c2c4890ad3b886f29e0a7a5

반응 방정식

COc1cc2nccc(Cl)c2cc1OC
4-Chloro-6,7-dimethoxyquinoline
CCOC(=O)c1ccccc1O
ethyl salicylate
CCOC(=O)c1ccccc1Oc1ccnc2cc(OC)c(OC)cc12
title compound
수율 63.3%
CCOC(=O)c1ccccc1Oc1ccnc2cc(OC)c(OC)cc12
Ethyl 2-[(6,7-dimethoxy-4-quinolyl)oxy]benzoate
수율 63.3%

반응 조건

온도
120°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도The reaction solution was cooled to room temperature
  2. 2
    기타the solvent was removed by distillation under the reduced pressure
  3. 3
    workup.ADDITIONWater was then added to the residue
  4. 4
    추출the mixture was extracted with chloroform
  5. 5
    세척The chloroform layer was washed with water
  6. 6
    건조was dried over anhydrous sodium sulfate
  7. 7
    기타The solvent was removed
  8. 8
    workup.DISTILLATIONby distillation under the reduced pressure
  9. 9
    기타the residue was purified by column chromatography

실험 절차

4-Chloro-6,7-dimethoxyquinoline (100 mg), ethyl salicylate (336 mg), and 4-dimethylaminopyridine (244 mg) were suspended in o-dichlorobenzene (1 ml), and the suspension was stirred at 120° C. overnight. The reaction solution was cooled to room temperature, and the solvent was removed by distillation under the reduced pressure. Water was then added to the residue, and the mixture was extracted with chloroform. The chloroform layer was washed with water and was dried over anhydrous sodium sulfate. The solvent was removed therefrom by distillation under the reduced pressure, and the residue was purified by column chromatography using acetone-hexane to give the title compound (100 mg, yield 56%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07560558B2uspto-grants-2009_07