반응 #3152

ord-9102e88c394640fc8efd773b9c3e0835

반응 방정식

[O-2].[O-2].[Ti+4]
titanium dioxide
[O-2].[O-2].[Ti+4]
titanium dioxide
O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
phosphorus pentoxide
[O-2].[O-2].[Ti+4]
titanium dioxide
O=P(O)(O)O
phosphoric acid
O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
phosphorus pentoxide
O=P([O-])([O-])OP(=O)([O-])[O-].[Ti+4]
titanium pyrophosphate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONThe reactants are thoroughly mixed
  2. 2
    온도heated at temperatures of about 400° C. to about 500° C.

실험 절차

The method of the present invention generally involves the mixture of titanium dioxide and hot concentrated phosphoric acid in a reaction vessel. The reaction mixture has a phosphorus pentoxide to titanium dioxide mole ratio greater than one. Preferably, the phosphorus pentoxide to titanium dioxide mole ratio is about 1.06 or more, and most preferably about 1.20 to about 1.25. The reactants are thoroughly mixed and heated at temperatures of about 400° C. to about 500° C. to produce a fine titanium pyrophosphate powder having a significantly higher fines yield over conventional titanium pyrophosphate processes. The fines yield is greater than 90% when using a phosphorus pentoxide to titanium dioxide mole ratio of about 1.20 to about 1.25.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05733519uspto-grants-1998_03