반응 #2572

ord-06bcb6d3c8c846a7a6b2788898b644c4

반응 방정식

[Na+].[OH-]
sodium hydroxide
Cl
hydrochloric acid
[Sn]
tin
COc1ccccc1N(CCN1CCC(C(=O)c2ccc(F)cc2)CC1)C(=O)c1ccc([N+](=O)[O-])cc1
4-Nitro-N-{2-[4-(4-fluorobenzoyl)piperidino]ethyl}-N-(2-methoxyphenyl)benzamide
COc1ccccc1N(CCN1CCC(C(=O)c2ccc(F)cc2)CC1)C(=O)c1ccc(N)cc1
title compound
수율 98.3%
COc1ccccc1N(CCN1CCC(C(=O)c2ccc(F)cc2)CC1)C(=O)c1ccc(N)cc1
4-Amino-N-{2[4-(4-fluorobenzoyl)piperidino]ethyl}-N-(2-methoxy-phenyl)benzamide
수율 98.3%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도while cooling in an ice bath
  2. 2
    기타to remove insoluble materials
  3. 3
    세척The resulting residue was washed with chloroform
  4. 4
    추출the filtrate was extracted with chloroform
  5. 5
    세척the resulting organic layer was washed with water and saturated brine
  6. 6
    건조dried on anhydrous sodium sulfate
  7. 7
    기타Thereafter, the solvent was removed by evaporation
  8. 8
    기타the resulting residue was purified by a silica gel column chromatography (chloroform:methanol=10:1)

실험 절차

4-Nitro-N-{2-[4-(4-fluorobenzoyl)piperidino]ethyl}-N-(2-methoxyphenyl)benzamide (264.0 mg, 0.52 mmol) was dissolved in methanol (5 ml) to which were subsequently added concentrated hydrochloric acid (2.0 ml) and tin (powder, 186.0 mg, 1.57 mmol) while cooling in an ice bath. After 1 hour of stirring at room temperature, the reaction solution was poured in ice water, adjusted to pH 9 to 10 with 10% sodium hydroxide aqueous solution, mixed with chloroform and then passed through cerite to remove insoluble materials. The resulting residue was washed with chloroform, the filtrate was extracted with chloroform, and the resulting organic layer was washed with water and saturated brine, and dried on anhydrous sodium sulfate. Thereafter, the solvent was removed by evaporation, and the resulting residue was purified by a silica gel column chromatography (chloroform:methanol=10:1) to obtain 243.0 mg (97.9%) of the title compound in a colorless amorphous form.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05728835uspto-grants-1998_03