반응 #2487471

ord-51780719cc14420aaa9b7b3b43e584c0

반응 방정식

Cl
hydrochloric acid
O
water
CCC(C)c1cc2cc(OC)c(Cl)cc2n1Cc1cccc(C(=O)OC)n1
methyl 6-[2-(butan-2-yl)-6-chloro-5-methoxyindol-1-ylmethyl]pyridine-2-carboxylate
[Na+].[OH-]
sodium hydroxide
CCC(C)c1cc2cc(OC)c(Cl)cc2n1Cc1cccc(C(=O)O)n1
title compound
수율 98.6%
CCC(C)c1cc2cc(OC)c(Cl)cc2n1Cc1cccc(C(=O)O)n1
6-[2-(Butan-2-yl)-6-chloro-5-methoxyindol-1-ylmethyl]pyridine-2-carboxylic acid
수율 98.6%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타to separate the organic layer
  2. 2
    세척The organic layer was washed with water twice
  3. 3
    건조dried over anhydrous sodium sulfate
  4. 4
    농축concentrated under reduced pressure

실험 절차

To a solution of methyl 6-[2-(butan-2-yl)-6-chloro-5-methoxyindol-1-ylmethyl]pyridine-2-carboxylate (200 mg) in tetrahydrofuran (3.08 mL) and methanol (1.32 mL) was added 2 mol/L aqueous sodium hydroxide solution (0.775 mL) at room temperature, followed by stirring for 2.5 hours. To the reaction mixture was added 1 mol/L hydrochloric acid (1.55 mL). To the mixture were added water and ethyl acetate to separate the organic layer. The organic layer was washed with water twice, dried over anhydrous sodium sulfate, and then concentrated under reduced pressure to obtain the title compound (190 mg). 1H-NMR (DMSO-d6) δ ppm: 0.77 (3H, t, J=7.4 Hz), 1.17 (3H, d, J=6.9 Hz), 1.40-1.70 (2H, m), 2.80-2.95 (1H, m), 3.83 (3H, s), 5.45-5.65 (2H, m), 6.30 (1H, s), 6.70 (1H, d, J=7.3 Hz), 7.20 (1H, s), 7.55 (1H, s), 7.80-7.95 (2H, m), 13.00-13.50 (1H, br).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08796247B2uspto-grants-2014_08