반응 #2487459

ord-c46d49bd7d2b4c32b3c3d6cc355df3b6

반응 방정식

CC(C)(C)OC(=O)Nc1ccc(C2CC2)cc1CC(=O)c1ccccc1
tert-butyl[4-cyclopropyl-2-(2-oxo-2-phenylethyl)phenyl]carbamate
O=C(O)C(F)(F)F
trifluoroacetic acid
c1ccc(-c2cc3cc(C4CC4)ccc3[nH]2)cc1
title compound
수율 85.1%
c1ccc(-c2cc3cc(C4CC4)ccc3[nH]2)cc1
5-Cyclopropyl-2-phenyl-1H-indole
수율 85.1%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도cooling
  2. 2
    농축The reaction mixture was concentrated under reduced pressure
  3. 3
    workup.ADDITIONTo the residue were added ethyl acetate and saturated aqueous sodium hydrogen carbonate solution
  4. 4
    기타to separate the organic layer
  5. 5
    세척The organic layer was washed with saturated brine
  6. 6
    건조dried over anhydrous sodium sulfate
  7. 7
    농축concentrated under reduced pressure
  8. 8
    기타The residue was purified by silica gel column chromatography (eluting solvent: ethyl acetate-hexane)

실험 절차

To a solution of tert-butyl[4-cyclopropyl-2-(2-oxo-2-phenylethyl)phenyl]carbamate (561 mg) in dichloromethane (8 mL) was added dropwise trifluoroacetic acid (1.6 mL) under ice-cooling. The mixture was heated to room temperature, and then stirred for 23 hours. The reaction mixture was concentrated under reduced pressure. To the residue were added ethyl acetate and saturated aqueous sodium hydrogen carbonate solution to separate the organic layer. The organic layer was washed with saturated brine, dried over anhydrous sodium sulfate, and then concentrated under reduced pressure. The residue was purified by silica gel column chromatography (eluting solvent: ethyl acetate-hexane) to obtain the title compound (317 mg). 1H-NMR (CDCl3) δ ppm: 0.65-0.75 (2H, m), 0.85-1.00 (2H, m), 1.95-2.10 (1H, m), 6.70-6.80 (1H, m), 6.90-7.00 (1H, m), 7.25-7.50 (5H, m), 7.60-7.70 (2H, m), 8.24 (1H, br s).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08796247B2uspto-grants-2014_08