반응 #2467942

ord-727fd310fe214d09987931d38cabf0e6

반응 방정식

COC(=O)C(Cc1ccccc1)NC(=O)c1nc(-c2ccccc2)cs1
3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid methyl ester
[K+].[OH-]
KOH
O=C(NC(Cc1ccccc1)C(=O)O)c1nc(-c2ccccc2)cs1
3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid
수율 83.7%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타After the solvent was evaporated from the reaction mixture
  2. 2
    workup.DISSOLUTIONthe residue was dissolved
  3. 3
    workup.ADDITIONby adding water
  4. 4
    기타The produced precipitates
  5. 5
    여과were filtered with suction
  6. 6
    세척washed with water

실험 절차

To a solution of 3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid methyl ester (74 mg, 0.2 mmol) dissolved in ethanol (4 mL) was added 1N—KOH (0.5 mL, 0.5 mmol) and the mixture was stirred at room temperature for 2 hours. After the solvent was evaporated from the reaction mixture, the residue was dissolved by adding water and acidified (H=2) with 2N—HCl under ice cooling. The produced precipitates were filtered with suction, washed with water to afford 59 mg (yield 80%) of the desired 3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid as white solids.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08257931B2uspto-grants-2012_09