반응 #2460290

ord-75b51aae8e8d4272b4580c5502570f52

반응 방정식

CCC(C)(C)c1ccc(Oc2ccccc2C(=O)OC)c(C(C)(C)CC)c1
methyl 2,4-di-(tert-amyl)phenoxybenzoate
[K+].[OH-]
potassium hydroxide
CCO
ethanol
CCC(C)(C)c1ccc(Oc2ccccc2C(=O)O)c(C(C)(C)CC)c1
2,4-di-(tert-amyl)phenoxybenzoic acid

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타Next 2,4-di-(tert-amyl)phenoxybenzoic acid was prepared
  2. 2
    온도was heated
  3. 3
    온도at reflux for 4 h
  4. 4
    온도cooled
  5. 5
    세척the mixture was washed twice with 10% aqueous HCl
  6. 6
    건조The organic layer was dried (Na2SO4)
  7. 7
    기타the solvent was removed at reduced pressure
  8. 8
    기타This crude product was purified by recrystallization from heptane

실험 절차

Next 2,4-di-(tert-amyl)phenoxybenzoic acid was prepared. A mixture of methyl 2,4-di-(tert-amyl)phenoxybenzoate (7.44 g, 20 mmol), potassium hydroxide (2.3 g, 40 mmol), and ethanol (60 mL) was heated at reflux for 4 h and then cooled to ambient. Diethyl ether (20 mL) was added, and the mixture was washed twice with 10% aqueous HCl. The organic layer was dried (Na2SO4) and the solvent was removed at reduced pressure to deposit a yellow solid. This crude product was purified by recrystallization from heptane to provide 5.0 g, 70% of theory) of 2,4-di-(tert-amyl)phenoxybenzoic acid as a tan solid. 1H NMR (CDCl3): δ 0.75 (t, 6H), 1.3 (s, 6H), 1.4 (s, 6H), 1.65 (q, 2H), 1.80 (q, 2H), 3.85 (s, 3H), 6.80 (d, 2H), 7.15 (m, 2H), 7.35(br s, 1H), 7.45 (t, 1H), 8.2 (d, 1H).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07459263B2uspto-grants-2008_12