반응 #2446080

ord-2c48b181bbf344fa9c375c6ba6d9d031

반응 방정식

CC(O)CN(C(=O)OC(C)(C)C)C1CCCCC1
tert-butyl cyclohexyl(2-hydroxypropyl)carbamate
Cc1cc(C)c(C(=O)Cl)c(C)c1
2,4,6-trimethyl-benzoyl chloride
Cc1cc(C)c(C(=O)OC(C)CN(C(=O)OC(C)(C)C)C2CCCCC2)c(C)c1
1-((tert-butoxycarbonyl)(cyclohexyl)amino)propan-2-yl 2,4,6-trimethylbenzoate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타The resultant reaction mixture
  2. 2
    세척washed with water and brine
  3. 3
    건조The organic layer was dried over sodium sulphate
  4. 4
    농축concentrated to dryness

실험 절차

To a solution of tert-butyl cyclohexyl(2-hydroxypropyl)carbamate (1 g, 3.89 mmol) in dry toluene (10 ml), 2,4,6-trimethyl-benzoyl chloride (0.510 mL, 4.280 mmol) was added. The resultant reaction mixture was stirred at rt for 16 hours. The reaction mixture was diluted in ethyl acetate and washed with water and brine. The organic layer was dried over sodium sulphate, and concentrated to dryness to obtain 1-((tert-butoxycarbonyl)(cyclohexyl)amino)propan-2-yl 2,4,6-trimethylbenzoate. Yield: 1 g (64.10%); LCMS: m/z=404.4 [M+H], RT=2.76 min, (Column: Y, Program: P1)

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08685418B2uspto-grants-2014_04