반응 #2275765

ord-96d423cb081e4ff3b151feca3af765ac

반응 방정식

O=C(Cl)c1ccc2c(c1)OCO2
Benzo[1,3]dioxole-5-carbonyl chloride
NC1CCC(N2CC(NC(=O)CNC(=O)c3cccc(C(F)(F)F)c3)C2)CC1.O=C(O)C(F)(F)F
N-{[1-(4-amino-cyclohexyl)-azetidin-3-ylcarbamoyl]-methyl}-3-trifluoromethyl-benzamide TFA salt
O=C(CNC(=O)c1cccc(C(F)(F)F)c1)NC1CN(C2CCC(NC(=O)c3ccc4c(c3)OCO4)CC2)C1
title compound
O=C(CNC(=O)c1cccc(C(F)(F)F)c1)NC1CN(C2CCC(NC(=O)c3ccc4c(c3)OCO4)CC2)C1
Benzo[1,3]dioxole-5-carboxylic acid (4-{3-[2-(3-trifluoromethyl-benzoylamino)-acetylamino]-azetidin-1-yl}-cyclohexyl)-amide

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타quenched with saturated sodium bicarbonate
  2. 2
    기타The reaction was then partitioned between DCM and water
  3. 3
    기타The organic layer was separated
  4. 4
    추출the aqueous layer was extracted 3 times with a chloroform/IPA “cocktail” (˜3:1
  5. 5
    건조The combined organic layer was dried over anhydrous Na2SO4
  6. 6
    여과filtered
  7. 7
    농축concentrated
  8. 8
    기타to give the crude product, which
  9. 9
    기타was then purified by a CombiFlash® system

실험 절차

Benzo[1,3]dioxole-5-carbonyl chloride (Aldrich, 74 mg, 0.404 mmol) was added into a solution of N-{[1-(4-amino-cyclohexyl)-azetidin-3-ylcarbamoyl]-methyl}-3-trifluoromethyl-benzamide TFA salt (as prepared in the previous step 200 mg, 0.404 mmol) and TEA (170 μL, 1.21 mmol) in DCM (5 mL) at 0° C. The reaction was stirred for an additional 2 hours and quenched with saturated sodium bicarbonate. The reaction was then partitioned between DCM and water. The organic layer was separated and the aqueous layer was extracted 3 times with a chloroform/IPA “cocktail” (˜3:1, v/v). The combined organic layer was dried over anhydrous Na2SO4, filtered and concentrated to give the crude product, which was then purified by a CombiFlash® system using ethyl acetate and 7N NH3 in MeOH as eluent (from pure ethyl acetate to 5% 7N NH3 in MeOH in ethyl acetate) to afford the title compound as white solid.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08324186B2uspto-grants-2012_12