반응 #2275714

ord-a1f810d85aa74c11873e635f3a7b99c3

반응 방정식

CC(C)(C)OC(=O)CNC(=O)c1ncc(OCc2ccccc2)cc1OCc1ccccc1
[(3,5-bis-benzyloxy-pyridine-2-carbonyl)-amino]-acetic acid tert-butyl ester
CC(C)(C)OC(=O)CNC(=O)c1ncc(O)cc1O
desired compound
수율 66.0%
CC(C)(C)OC(=O)CNC(=O)c1ncc(O)cc1O
[(3,5-dihydroxy-pyridine-2-carbonyl)-amino]-acetic acid tert-butyl ester
수율 66.0%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    여과The suspension is then filtered through Celite™
  2. 2
    농축concentrated under reduced pressure
  3. 3
    기타the crude product purified over silica (2.5% MeOH/CH2Cl2)

실험 절차

A solution of [(3,5-bis-benzyloxy-pyridine-2-carbonyl)-amino]-acetic acid tert-butyl ester, 26, (3.04 g, 6.79 mmol) in EtOH (100 mL) containing 10% Pd/C (0.300 g) is stirred under an atmosphere of H2 for 22 hours. The suspension is then filtered through Celite™, concentrated under reduced pressure, and the crude product purified over silica (2.5% MeOH/CH2Cl2) to afford 1.20 g (66% yield) of the desired compound as a colorless oil. 1H NMR (250 MHz, CDCl3) δ ppm 11.90 (1H, br s), 8.94 (1H, br s), 8.20 (1H, t, J=5.6 Hz), 7.76 (1H, d, J=2.4 Hz), 6.77 (1H, d, J=2.1 Hz), 4.13 (2H, d, J=5.5 Hz), 1.53 (9H, s). HPLC-MS: m/z 269 [M+H]+.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08323671B2uspto-grants-2012_12