반응 #2275683

ord-698cbab603854742b1347453baeb6691

반응 방정식

CNc1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I
2,4,6-Triiodo-5-methylamino-isophthaloyl dichloride
CC(=O)OCC(=O)Cl
acetoxyacetyl chloride
CC(=O)OCC(=O)N(C)c1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I
acetic acid [(3,5-bis-chlorocarbonyl-2,4,6-triiodo-phenyl)-methyl-carbamoyl]-methyl ester
수율 69.8%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONThe reaction mixture was poured slowly onto ice-water (300 ml)
  2. 2
    기타a white solid was isolated by filtration
  3. 3
    세척washed with water
  4. 4
    기타The ethyl acetate was collected
  5. 5
    건조dried over MgSO4
  6. 6
    여과filtered
  7. 7
    기타evaporated
  8. 8
    기타to give a white solid
  9. 9
    기타This was purified by silica column chromatography
  10. 10
    세척eluting with petrol

실험 절차

2,4,6-Triiodo-5-methylamino-isophthaloyl dichloride (20 g, 32.8 mmol) was dissolved in DMA (60 ml) and acetoxyacetyl chloride (15.32 ml, 142 mmol) was added. The reaction was stirred overnight at room temperature with nitrogen bubbling through the reaction mixture. The reaction mixture was poured slowly onto ice-water (300 ml) and a white solid was isolated by filtration. The solid was dissolved in ethyl acetate and washed with water. The ethyl acetate was collected, dried over MgSO4, filtered and evaporated to give a white solid. This was purified by silica column chromatography eluting with petrol:ethyl acetate to give acetic acid [(3,5-bis-chlorocarbonyl-2,4,6-triiodo-phenyl)-methyl-carbamoyl]-methyl ester (16.25 g, 22.9 mmol).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08323619B2uspto-grants-2012_12