반응 #2122523

ord-8c640b24d8654cc39733a0f73dd9ab82

반응 방정식

O=C(OCc1ccccc1)[C@@H](O)c1ccccc1
(S)-benzyl 2-hydroxy-2-phenylacetate
CCN(CC)CC
triethylamine
Cc1ccc(S(=O)(=O)Cl)cc1
p-toluenesulfonyl chloride
Cc1ccc(S(=O)(=O)OC(C(=O)OCc2ccccc2)c2ccccc2)cc1
benzyl 2-phenyl-2-(tosyloxy)acetate

반응 조건

온도
0°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도while maintaining the temperature between −5° C. and 0° C
  2. 2
    workup.WAITstored in a freezer (−25° C.) for 14 hours
  3. 3
    기타thaw to ambient temperature
  4. 4
    세척washed with water (200 mL), 1N HCl (100 mL) and brine (100 mL)
  5. 5
    건조dried (MgSO4)
  6. 6
    여과filtered
  7. 7
    농축concentrated in vacuo

실험 절차

A CH2Cl2 (200 mL) solution of p-toluenesulfonyl chloride (8.65 g, 45.4 mmol) was added dropwise to a cooled (−5° C.) CH2Cl2 (200 mL) solution of (S)-benzyl 2-hydroxy-2-phenylacetate (10.0 g, 41.3 mmol), triethylamine (5.75 mL, 41.3 mmol) and 4-dimethylaminopyridine (0.504 g, 4.13 mmol), while maintaining the temperature between −5° C. and 0° C. The reaction was stirred at 0° C. for 9 hours, and then stored in a freezer (−25° C.) for 14 hours. It was allowed to thaw to ambient temperature and washed with water (200 mL), 1N HCl (100 mL) and brine (100 mL), dried (MgSO4), filtered, and concentrated in vacuo to provide benzyl 2-phenyl-2-(tosyloxy)acetate as a viscous oil which solidified upon standing (16.5 g). The chiral integrity of the product was not checked and that product was used for the next step without further purification. 1H NMR (DMSO-d6, δ=2.5, 500 MHz) δ 7.78 (d, J=8.6, 2H), 7.43-7.29 (m, 10H), 7.20 (m, 2H), 6.12 (s, 1H), 5.16 (d, J=12.5, 1H), 5.10 (d, J=12.5, 1H), 2.39 (s, 3H). RT=3.00 (Cond. 3); >90% homogeneity index; LC/MS: Anal. Calcd. for [M+H]+ C22H20NaO5S: 419.09; found 419.04.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08574563B2uspto-grants-2013_11