반응 #2063070

ord-20a44e61cd5840c099fe97ad0dcfd5e1

반응 방정식

CC(C)(C#N)N=NC(C)(C)C#N
2,2′-azobisisobutyronitrile
CCC1=CC(=O)NC1=O
Ethyl maleimide
CC(C)(C)OC(=O)C1CC2C=CC1C2
t-butyl 5-norbornene-2-carboxylate
O=C(OCCO)C1CC2C=CC1C2
2-hydroxyethyl 5-norbornene-2-carboxylate
CC(C)(C)OC(=O)C1CC2C=CC1C2.CCC1=CC(=O)NC1=O.O=C(OCCO)C1CC2C=CC1C2
ethyl maleimide t-butyl 5-norbornene-2-carboxylate 2-hydroxyethyl 5-norbornene-2-carboxylate
수율 85.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타the resulting solution was reacted at a temperature between 60° C. and 70° C. in a nitrogen atmosphere for 10 hours
  2. 2
    기타After a high molecular weight was achieved by the reaction
  3. 3
    기타the resultant product was precipitated in an ethyl ether or hexane solvent
  4. 4
    기타The gathered precipitate was dried
  5. 5
    기타was obtained at a yield of about 85%

실험 절차

Ethyl maleimide (1 mol.), t-butyl 5-norbornene-2-carboxylate (0.5 mol.) and 2-hydroxyethyl 5-norbornene-2-carboxylate (0.5 mol) were dissolved in 50 g to 300 g of tetrahydrofuran (THF), 2 g to 15 g of 2,2′-azobisisobutyronitrile (AIBN) was added thereto, and the resulting solution was reacted at a temperature between 60° C. and 70° C. in a nitrogen atmosphere for 10 hours. After a high molecular weight was achieved by the reaction, the resultant product was precipitated in an ethyl ether or hexane solvent. The gathered precipitate was dried, and the desired poly(ethyl maleimide/t-butyl 5-norbornene-2-carboxylate/2-hydroxyethyl 5-norbornene-2-carboxylate) polymer was obtained at a yield of about 85%. NMR spectra of the polymer is illustrated in FIG. 2.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06225020B1uspto-grants-2001_05