반응 #2002

ord-8d15441bff9244cf8bac899003f74801

반응 방정식

O
water
CC(C)(C)OC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O
t-butoxycarbonyl-D-tryptophan
OCc1ccccc1
benzyl alcohol
CCN=C=NCCCN(C)C.Cl
1-(3-dimethylaminopropyl)-3-ethylcarbodiimide hydrochloride
CC(C)(C)OC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1
N-(t-Butoxycarbonyl)-D-tryptophan benzyl ester

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.STIRRINGThe reaction mixture was stirred for 3 hours at room temperature during which time the reaction mixture
  2. 2
    추출extracted with methylene chloride (2×50 mL)
  3. 3
    세척The combined methylene chloride layers were washed with 5% aqueous citric acid solution (100 mL) and 5% aqueous sodium bicarbonate solution (100 mL)
  4. 4
    건조The resulting methylene chloride layer was dried over magnesium sulfate
  5. 5
    여과filtered
  6. 6
    기타evaporated under vaccum
  7. 7
    기타to give an off-white solid
  8. 8
    기타This solid material was chromatographed on silica gel

실험 절차

Finely divided t-butoxycarbonyl-D-tryptophan (3 g, 10 mmol) was suspended in methylene chloride and benzyl alcohol (1.08 mL, 10 mmol) and 4-dimethylaminopyridine (0.12 g, 1 mmol) were added and stirred at room temperature. Solid 1-(3-dimethylaminopropyl)-3-ethylcarbodiimide hydrochloride (1.92 g, 10 mmol) was then added in three roughly equal portions over 5 minutes. The reaction mixture was stirred for 3 hours at room temperature during which time the reaction mixture became a homogeneous solution. The reaction mixture was poured into water (100 mL) and extracted with methylene chloride (2×50 mL). The combined methylene chloride layers were washed with 5% aqueous citric acid solution (100 mL) and 5% aqueous sodium bicarbonate solution (100 mL). The resulting methylene chloride layer was dried over magnesium sulfate, filtered and evaporated under vaccum to give an off-white solid. This solid material was chromatographed on silica gel using ethyl acetate/hexanes (2:3 v/v) as eluant. This afforded 3.56 g (91%) of the desired benzyl ester as a white amorphous powder.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05726319uspto-grants-1998_03