반응 #1929095

ord-ee37bd2f63c045eea1190f05ba281759

반응 방정식

CCOP(=O)(OCC)C(CCCC(=O)OCOC(=O)SCC)P(=O)(OCC)OCC
Compound 56
CCOP(=O)(OCC)C(CCCC(=O)OCOC(=O)SCC)P(=O)(OCC)OCC
S-Ethyl O-(5,5-bis(diethylphosphono)pentanoyloxy)methyl carbonothioate
O=S(=O)(Cl)Cl
sulfuryl chloride
CCOP(=O)(OCC)C(CCCC(=O)OCOC(=O)Cl)P(=O)(OCC)OCC
(Carbonochloridoyloxy)methyl 5,5-bis(diethylphosphono)pentanoate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타After removal of the excess sulfuryl chloride in vacuo
  2. 2
    기타the crude acid chloride 57 was used directly in the next step without further purification

실험 절차

Compound 56 neat (519.2 mg, 1.054 mmol) was cooled in an ice/water bath and sulfuryl chloride (128 μL, 1.58 mmol) was carefully added. The reaction mixture was allowed to warm to room temperature and was stirred overnight. After removal of the excess sulfuryl chloride in vacuo, the crude acid chloride 57 was used directly in the next step without further purification. 1HNMR (400 MHz, CDCl3): δ 1.35 (t, J=7.0, 12H), 1.86-2.06 (m, 4H), 2.28 (tt, J=23.8, 6.2, 1H), 2.45 (t, J=7.0, 2H), 4.14-4.24 (m, 8H), 5.82 (s, 2H). 31P NMR (162 MHz, CDCl3) δ 24.34 (s, 2P)

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08946144B2uspto-grants-2015_02