반응 #1909783

ord-7ce88c7dda5943938f45e77c9310bb97

반응 방정식

CCOC(=O)C1(CC)CCN(C(=O)OC(C)(C)C)CC1
1-tert-butoxycarbonyl-4-ethylisonipecotic acid ethyl ester
[Li+].[OH-]
lithium hydroxide
CCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)CC1
title compound
수율 45.3%
CCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)CC1
1-tert-Butoxycarbonyl-4-ethylisonipecotic acid
수율 45.3%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도the mixture was refluxed
  2. 2
    온도under heating for 20 hours
  3. 3
    농축Then, the reaction mixture was concentrated
  4. 4
    workup.ADDITIONwater was added to the residue
  5. 5
    세척The aqueous layer was washed with ether
  6. 6
    추출extracted with ether
  7. 7
    건조The organic layer was dried over anhydrous magnesium sulfate
  8. 8
    농축concentrated under reduced pressure

실험 절차

To a solution of 1-tert-butoxycarbonyl-4-ethylisonipecotic acid ethyl ester (570 mg) in ethanol (10 ml) was added a 1M lithium hydroxide solution (8 ml), and the mixture was refluxed under heating for 20 hours. Then, the reaction mixture was concentrated, and water was added to the residue. The aqueous layer was washed with ether acidified with 1N hydrochloric acid, and extracted with ether. The organic layer was dried over anhydrous magnesium sulfate, and concentrated under reduced pressure to give the title compound (233 mg, yield 45%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: USRE039088E1uspto-grants-2006_05