반응 #1904038

ord-b9190018bb9a41e0888f68096d43b3c7

반응 방정식

N[C@@H](CC(=O)O)C(=O)O
aspartic acid
CCN(CC)CC
triethyl amine
O=C(Cl)CCC(=O)Cl
succinyl chloride
N[C@@H](CC(=O)O)C(=O)O.O=C1CCC(=O)N1
Aspartic Acid Succinimide

반응 조건

온도
0°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타fitted with a condenser and nitrogen inlet
  2. 2
    온도refluxed for 6 hours
  3. 3
    여과The triethyl amine hydrochloride is filtered
  4. 4
    농축the filtrate is concentrated
  5. 5
    기타by removing the solvent under vacuum
  6. 6
    기타The residue is used directly for the subsequent reaction
  7. 7
    기타The residue can be purified by chromatography on silica gel

실험 절차

This example that demonstrates how this method could be performed. 9.4 g aspartic acid, 10 ml triethyl amine and 100 ml tetrahydrofuran are transferred into a 100 ml flask fitted with a condenser and nitrogen inlet. The mixture is cooled to 0° C. and 5 g succinyl chloride is added and the mixture stirred under nitrogen atmosphere for 5 min and refluxed for 6 hours. The triethyl amine hydrochloride is filtered and the filtrate is concentrated by removing the solvent under vacuum. The residue is used directly for the subsequent reaction. The residue can be purified by chromatography on silica gel.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07597882B2uspto-grants-2009_10