반응 #1884

ord-a2fcb8e364ca4dd2ada72db56fde3611

반응 방정식

CC(C)N1C(=O)[C@@H](C/C=C/C(=O)O)O[C@H](c2ccccc2Cl)c2cc(Cl)ccc21
trans-7-chloro-5-(2-chlorophenyl)-1-isopropyl-2-oxo-1,2,3,5-tetrahydro-4,1-benzoxazepine-3-crotonic acid
[H][H]
hydrogen
CC(C)N1C(=O)[C@@H](CCCC(=O)O)O[C@H](c2ccccc2Cl)c2cc(Cl)ccc21
trans-7-chloro-5-(2-chlorophenyl)-1-isopropyl-2-oxo-1,2,3,5-tetrahydro-4,1-benzoxazepine-3-butyric acid
수율 81.8%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타to be absorbed
  2. 2
    기타the catalyst was removed
  3. 3
    workup.DISTILLATIONby distilling off ethyl acetate under reduced pressure
  4. 4
    기타The residue was crystallized from a small volume of hexane

실험 절차

In ethyl acetate (20 ml) was dissolved ethyl ester of trans-7-chloro-5-(2-chlorophenyl)-1-isopropyl-2-oxo-1,2,3,5-tetrahydro-4,1-benzoxazepine-3-crotonic acid (0.45 g). To the solution was added 10% palladium carbon (0.1 g), and the mixture was subjected to catalytic reduction at room temperatures under atmospheric pressure. The theoretical amount of hydrogen was allowed to be absorbed, then the catalyst was removed, followed by distilling off ethyl acetate under reduced pressure. The residue was crystallized from a small volume of hexane to give ethyl ester of trans-7-chloro-5-(2-chlorophenyl)-1-isopropyl-2-oxo-1,2,3,5-tetrahydro-4,1-benzoxazepine-3-butyric acid (0.37 g) as prisms, m.p.100°-101° C.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05726306uspto-grants-1998_03