반응 #1857549

ord-59a5b865941f4411885de22cebe2b8a9

반응 방정식

COC(=O)[C@@H](CC=C(C)C)[C@H](C)O
(S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhex-4-enoate
COC(=O)[C@@H](CCC(C)C)[C@H](C)O
title compound
수율 98.4%
COC(=O)[C@@H](CCC(C)C)[C@H](C)O
(S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhexanoate
수율 98.4%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    여과The mixture was filtered through a plug of Celite®
  2. 2
    세척the plug was washed with MeOH (20 mL)
  3. 3
    기타the solvent was removed under reduced pressure
  4. 4
    workup.DISSOLUTIONthe residue was dissolved in DCM (50 mL)
  5. 5
    기타to remove residual water (H2O)
  6. 6
    기타the solvent was removed under reduced pressure

실험 절차

To a well stirred solution of (S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhex-4-enoate (9.5 g, 51.0 mmol) in MeOH (51 mL) was added 10% Pd/C (0.543 g, 5.10 mmol). The reaction was put under a hydrogen atmosphere (balloon) and stirred at room temperature for 20 h. The mixture was filtered through a plug of Celite® and the plug was washed with MeOH (20 mL). The filtrate and washes were combined, the solvent was removed under reduced pressure, and the residue was dissolved in DCM (50 mL). The solution was passed through a phase separator to remove residual water (H2O), and the solvent was removed under reduced pressure to afford the title compound (9.45 g, 50.2 mmol, 98%) as a slightly yellow oil: IR (thin film) 3451, 2954, 2871, 1736, 1719, 1169 cm−1; 1H NMR (400 MHz, CDCl3) δ 3.91 (p, J=6.4 Hz, 1H), 3.72 (s, 3H), 2.77 (s, 1H), 2.36 (ddd, J=9.2, 6.3, 5.0 Hz, 1H), 1.72-1.45 (m, 3H), 1.28-1.05 (m, 5H), 0.88 (dd, J=6.6, 3.2 Hz, 6H); 13C NMR (75 MHz, CDCl3) δ 176.13, 68.55, 53.29, 51.67, 36.55, 28.16, 27.37, 22.74, 22.44, 21.68.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US09247741B2uspto-grants-2016_02