반응 #1781

ord-aaa0ddfbf41e452299afe064a36ec3cd

반응 방정식

CCc1ncccc1C(=O)[O-].[Li+]
2-ethyl nicotinic acid lithium salt
[Al+3].[H-].[H-].[H-].[H-].[Li+]
lithium aluminum hydride
CCc1ncccc1CO
2-ethyl-3 -hydroxymethylpyridine

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도then cooled to 0° C.
  2. 2
    기타quenched with EtOAc (949 μL)
  3. 3
    여과The solution was filtered
  4. 4
    기타the solvent removed under reduced pressure
  5. 5
    workup.ADDITIONToluene was added
  6. 6
    기타the solvent was removed under reduced pressure

실험 절차

The 2-ethyl nicotinic acid lithium salt (5 g, 3.18 mmol) in distilled THF (400 mL) under nitrogen was cooled to 0° C. and lithium aluminum hydride (1M in THF) (25 mL) was added dropwise. The reaction was stirred for 3 hours at room temperature then cooled to 0° C. and quenched with EtOAc (949 μL), then H2O (949 μL), then 15% NaOH (949 μL), followed by H2O (2.8 mL). The solution was filtered and the solvent removed under reduced pressure. Toluene was added and the solvent was removed under reduced pressure to give the desired 2-ethyl-3 -hydroxymethylpyridine.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05726172uspto-grants-1998_03