반응 #1702096

ord-f3453c449dbe4886a96a657d349ed864

반응 방정식

CCOP(C)(=O)CCNc1cc(C#CC(C)(C)C)sc1C(=O)OC
5-(3,3-Dimethyl-but-1-ynyl)-3-[2-(ethoxy-methyl-phosphinoyl)-ethylamino]-thiophene-2-carboxylic acid methyl ester
CC1CCC(C(=O)Cl)CC1
4-methyl-cyclohexanecarbonyl chloride
CCOP(C)(=O)CCN(C(=O)C1CCC(C)CC1)c1cc(C#CC(C)(C)C)sc1C(=O)OC
5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(ethoxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid methyl ester
수율 80.5%

반응 조건

온도
100°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도the heat to the oil bath
  2. 2
    workup.STIRRINGto stir for a further 9 hours
  3. 3
    추출extracted with H2O
  4. 4
    추출The organic phase was then extracted with brine
  5. 5
    건조dried over Na2SO4
  6. 6
    기타The drying agent was removed by vacuum filtration
  7. 7
    농축the filtrate was concentrated

실험 절차

5-(3,3-Dimethyl-but-1-ynyl)-3-[2-(ethoxy-methyl-phosphinoyl)-ethylamino]-thiophene-2-carboxylic acid methyl ester (233 mg, 0.629 mmol) was dissolved in pyridine (4 mL) and then 4-methyl-cyclohexanecarbonyl chloride (506 mg, 3.15 mmol) was added. The reaction was stirred for 7 hours at 100° C., the heat to the oil bath was shut off and the reaction was allowed to stir for a further 9 hours. The reaction was diluted with EtOAc and extracted with H2O. The organic phase was then extracted with brine and dried over Na2SO4. The drying agent was removed by vacuum filtration and the filtrate was concentrated. 5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(ethoxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid methyl ester (251 mg, 78%) was isolated from the residue by silica gel column chromatography.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08765722B2uspto-grants-2014_07