반응 #1702024

ord-a0e4f3e74c53462898db953c8a49c170

반응 방정식

O=C(O)c1cccc(C(=O)O)c1
isophthalic acid
Nc1ccccc1O
aminophenol
O=C(O)c1ccc2cc(O)ccc2c1
2-hydroxy-6-naphthoic acid
CC(=O)OC(C)=O
acetic anhydride
O=C1C=CC(=O)N1
maleimide
O=C(O)c1ccccc1N1C(=O)C=CC1=O
maleimidobenzoic acid
O=C(O)c1ccccc1
benzoic acid
C#C.O=C(O)c1ccccc1
acetylene benzoic acid

반응 조건

온도
320°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타Alternatively, the liquid crystalline thermoset oligomer can be prepared by a bulk polymerization process in accordance with the following procedure
  2. 2
    온도to reflux for a predetermined time period
  3. 3
    기타Acetic acid as a by-product and unreacted acetic anhydride are removed from the reaction mixture
  4. 4
    workup.ADDITIONNext, 4-hydroxybenzoic acid is added
  5. 5
    온도the reaction temperature is maintained which
  6. 6
    기타the reaction
  7. 7
    기타to give a liquid crystal oligomer

실험 절차

Alternatively, the liquid crystalline thermoset oligomer can be prepared by a bulk polymerization process in accordance with the following procedure. In another exemplary method, isophthalic acid, aminophenol, 2-hydroxy-6-naphthoic acid and acetic anhydride are slowly heated to 150° C. with stirring in a reactor. The mixture is brought to reflux for a predetermined time period. Acetic acid as a by-product and unreacted acetic anhydride are removed from the reaction mixture. Next, 4-hydroxybenzoic acid is added, and the temperature is further raised to 320° C. and the reaction temperature is maintained which allows the reaction to proceed, to give a liquid crystal oligomer having one or two terminal alcohol groups at one or both ends of the backbone. The liquid crystal oligomer is dissolved in a proper solvent (e.g., N,N-dimethylformamide, abbreviated “DMF”), and then a compound (e.g., maleimidobenzoic acid, nadimide benzoic acid, or acetylene benzoic acid) capable of providing thermally crosslinkable reactive groups (e.g., maleimide, nadimide or acetylene groups) is added to the solution. The mixture is allowed to react to give the liquid crystalline thermoset oligomer having one or two thermally crosslinkable reactive groups at one or both ends of the backbone thereof.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08765012B2uspto-grants-2014_07