반응 #1605799

ord-2a40e6429aeb40aa9905f622e7ded49f

반응 방정식

[N-]=[N+]=NC[C@H](O)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12
5-((R)-2-Azido-1-hyroxyethyl)-8-benzyloxy-1H-quinolin-2-one
CC(=O)O
acetic acid
CC(=O)O.NC[C@H](O)c1ccc(O)c2[nH]c(=O)ccc12
5-((R)-2-amino-1-hyroxyethyl)-8-hydroxy-1H-quinolin-2-one acetate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타The catalyst was removed by filtration
  2. 2
    농축the filtrate was concentrated under reduced pressure
  3. 3
    workup.ADDITIONTo the residue were added methanol (100 mL) and ethyl acetate (100 mL)
  4. 4
    workup.STIRRINGthe mixture was stirred
  5. 5
    여과The precipitate was collected by filtration
  6. 6
    기타dried

실험 절차

5-((R)-2-Azido-1-hyroxyethyl)-8-benzyloxy-1H-quinolin-2-one (16.8 g, 49.9 mol) was suspended in acetic acid (50 mL), a catalytic amount of palladium hydroxide-carbon was added thereto, and the solution was stirred under a hydrogen atmosphere overnight. The catalyst was removed by filtration and the filtrate was concentrated under reduced pressure. To the residue were added methanol (100 mL) and ethyl acetate (100 mL), and the mixture was stirred. The precipitate was collected by filtration and dried to obtain 5-((R)-2-amino-1-hyroxyethyl)-8-hydroxy-1H-quinolin-2-one acetate (12.5 g).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US09072734B2uspto-grants-2015_07