반응 #1483034

ord-cce2c988fe3744559e6927abad67dcee

반응 방정식

CC(C)(C)OC(=O)NCCN
tert-butyl 2-aminoethylcarbamate
CCN(CC)CC
Et3N
O=C(O)c1cccnc1
nicotinic acid
O=C(Cl)C(=O)Cl
oxalyl chloride
CC(C)(C)OC(=O)NCCNC(=O)c1cccnc1
tert-butyl 2-(nicotinamido)ethylcarbamate
수율 74.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.DISSOLUTIONhad dissolved
  2. 2
    기타(1 h)
  3. 3
    기타The resulting reaction mixture
  4. 4
    온도was warmed to room temperature
  5. 5
    workup.STIRRINGstirred for 2 h
  6. 6
    세척It was then washed with brine
  7. 7
    건조dried over Na2SO4
  8. 8
    여과filtered
  9. 9
    농축concentrated under reduced pressure
  10. 10
    기타Purification by silica gel chromatography (CH2Cl2)

실험 절차

In a typical run, nicotinic acid (2.0 g, 16.2 mmol) was taken up in CH2Cl2 (20 mL) along with oxalyl chloride (1.4 mL, 16.2 mmol). After a few drops of DMF were added, the reaction mixture was stirred at room temperature until all the solids had dissolved and all gas evolution had ceased (1 h). This freshly prepared solution of the acid chloride was added dropwise at 0° C. to a solution containing tert-butyl 2-aminoethylcarbamate (2.6 g, 16.2 mmol) and Et3N (3.4 mL, 24.2 mmol) in CH2Cl2 (200 mL). The resulting reaction mixture was warmed to room temperature and stirred for 2 h. It was then washed with brine, dried over Na2SO4, filtered and concentrated under reduced pressure. Purification by silica gel chromatography (CH2Cl2) afforded tert-butyl 2-(nicotinamido)ethylcarbamate (3.1 g, 74%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: USRE045275E1uspto-grants-2014_12