반응 #1458426

ord-d9125d3c4a3b428e8432974472c5764b

반응 방정식

O
water
S=[PH](c1ccccc1)c1ccccc1
diphenylphosphine sulfide
O=C(CCl)c1ccccc1
chloroacetophenone
[K+].[OH-]
potassium hydroxide
O=C(CP(=S)(c1ccccc1)c1ccccc1)c1ccccc1
Phenylcarbonylmethyl-diphenylphosphine sulfide

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도was cooled to 8–10° C. in an ice-water bath
  2. 2
    기타the organic layer was separated
  3. 3
    세척washed with more water (2 ml)
  4. 4
    건조dried over sodium sulfate
  5. 5
    기타The solvent was removed under reduced pressure
  6. 6
    기타a rotary evaporator
  7. 7
    기타the oily residue was crystallized from ethyl acetate-hexane mixture
  8. 8
    기타to give 0.19 g (56.5%) of star

실험 절차

A stirred mixture of diphenylphosphine sulfide (0.218 g, 0.001 mol) and chloroacetophenone (0.216 g, 0.0014 mol) in methylene chloride (4 ml) was cooled to 8–10° C. in an ice-water bath. Small pieces of solid potassium hydroxide (0.196 g, 0.0035 mol) were added while stirring under nitrogen atmosphere. After 45 minute, water (2 ml) was added and the organic layer was separated, washed with more water (2 ml) and dried over sodium sulfate. The solvent was removed under reduced pressure using a rotary evaporator and the oily residue was crystallized from ethyl acetate-hexane mixture to give 0.19 g (56.5%) of star shaped crystals. mp=83–84° C.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07157219B2uspto-grants-2007_01