반응 #1435730

ord-422d960a922041c29902827a1bcca0d3

반응 방정식

Cl
hydrochloric acid
[H-].[Na+]
sodium hydride
CCOC(=O)Cc1c(F)cccc1Cl
ethyl 2-chloro-6-fluorophenylacetate
CC(=O)OC(C)=O
acetic anhydride
CCOC(=O)CC(=O)Cc1c(F)cccc1Cl
ethyl (2-chloro-6-fluorophenyl)acetoacetate
수율 35.8%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONwere added dropwise
  2. 2
    온도under reflux
  3. 3
    온도refluxed
  4. 4
    온도under heating for 10 hours
  5. 5
    온도The reaction mixture was cooled
  6. 6
    추출extracted with t-butyl methyl ether
  7. 7
    세척The organic layer was washed with dil. hydrochloric acid, aqueous saturated sodium bicarbonate solution, dil. hydrochloric acid and water
  8. 8
    건조subsequently, dried over sodium sulfate
  9. 9
    농축concentrated

실험 절차

Into a mixture of 9.6 g of sodium hydride (60% in oil) and 200 ml of tetrahydrofuran, 21.7 g of ethyl 2-chloro-6-fluorophenylacetate were added dropwise under reflux. Then, a solution of 12.3 g of acetic anhydride in 40 ml tetrahydrofuran was added thereto and refluxed under heating for 10 hours. The reaction mixture was cooled, poured into iced dil. hydrochloric acid and extracted with t-butyl methyl ether. The organic layer was washed with dil. hydrochloric acid, aqueous saturated sodium bicarbonate solution, dil. hydrochloric acid and water, subsequently, dried over sodium sulfate and concentrated. The residue was subjected to silica gel column chromatography to give 9.27 g of ethyl (2-chloro-6-fluorophenyl)acetoacetate.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07211545B2uspto-grants-2007_05