반응 #1435722

ord-21d514042e5546869747ebff7e22a158

반응 방정식

[H-].[K+]
potassium hydride
C[Si](C)(C)OCCCC1=CC=CC1
(3-trimethylsiloxy-propyl)-cyclopentadiene
C[Si](C)(C)OCCC[c-]1cccc1.[K+]
potassium (3-trimethylsiloxypropyl)-cyclopentadienide
수율 70.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONis added
  2. 2
    온도The reaction is maintained
  3. 3
    농축Subsequently, the resulting suspension is concentrated to dryness
  4. 4
    기타leaving an oily solid that, when it
  5. 5
    세척is washed with hexane
  6. 6
    기타gives a cream-coloured solid

실험 절차

To a suspension of 0.4 g (10 mmol) of potassium hydride in tetrahydrofurane, 1.96 g (10 mmol) of a (3-trimethylsiloxy-propyl)-cyclopentadiene in tetrahydrofurane is added. The reaction is maintained under stirring for 2 hours. Subsequently, the resulting suspension is concentrated to dryness, leaving an oily solid that, when it is washed with hexane, gives a cream-coloured solid. (1.6 g, 7 mmol. Yield:70%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07211538B2uspto-grants-2007_05