반응 #1435718

ord-14c3487f2344425e8598f66d19662062

반응 방정식

[H-].[K+]
potassium hydride
C[Si](C)(C)OCCC1=CC=CC1
(2-trimethylsiloxy-ethyl)-cyclopentadiene
C[Si](C)(C)OCC[c-]1cccc1.[K+]
potassium (2-trimethylsiloxy-ethyl)-cyclopentadienide
수율 81.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONis added
  2. 2
    온도The reaction is maintained
  3. 3
    기타leaving an oily solid which
  4. 4
    세척is washed with hexane in order
  5. 5
    기타to obtain a brown solid

실험 절차

To a suspension of 0.5 g (12.4 mmol) of potassium hydride in tetrahydrofurane, 2.25 g (12.4 mmol) of (2-trimethylsiloxy-ethyl)-cyclopentadiene in tetrahydrofurane is added. The reaction is maintained under stirring for 2 hours and then the volatile compounds are eliminated, leaving an oily solid which is washed with hexane in order to obtain a brown solid. (2.2 g Yield: 81%)

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07211538B2uspto-grants-2007_05