반응 #1384

ord-f9699d46336a408a989760bcba92ed2e

반응 방정식

[Na+].[OH-]
sodium hydroxide
Cc1c(F)c(Br)cc2c1c(=O)c(C(=O)O)cn2C1CC1
1-cyclopropyl-6-fluoro-7-bromo-5-methyl-1,4- dihydro-4-oxoquinoline-3-carboxylic acid
O=S(Cl)Cl
thionyl chloride
Cc1c(F)c(Cl)cc2c1c(=O)c(C(=O)O)cn2C1CC1
1-cyclopropyl-6-fluoro-7-chloro-5-methyl-1,4-dihydro-4-oxoquinoline-3-carboxylic acid

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도the mixture is refluxed for 1 hour
  2. 2
    온도After cooling
  3. 3
    추출the resultant is extracted with dichloromethane
  4. 4
    추출extracted with dichloroethane
  5. 5
    농축The solvent is concentrated
  6. 6
    기타the residue is recrystallized from acetic acid

실험 절차

To 1-cyclopropyl-6-fluoro-7-bromo-5-methyl-1,4- dihydro-4-oxoquinoline-3-carboxylic acid (0.2 g) is added thionyl chloride (2 ml) and the mixture is refluxed for 1 hour. After cooling, the reaction mixture is poured into ice-water and made alkaline with 10% aqueous sodium hydroxide solution. After stirring for 30 minutes, the resultant is extracted with dichloromethane. The aqueous layer is made acidic with 10% hydrochloric acid and then extracted with dichloroethane. The solvent is concentrated and the residue is recrystallized from acetic acid to give 1-cyclopropyl-6-fluoro-7-chloro-5-methyl-1,4-dihydro-4-oxoquinoline-3-carboxylic acid (80 mg), as white crystals, m.p. 258°-260° C.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05723648uspto-grants-1998_03