반응 #1381

ord-a382dee7401645edb9da6c1fce7078a0

반응 방정식

COC(=O)c1cccc([N+](=O)[O-])c1C
Methyl 2-methyl-3-nitrobenzoate
COC(=O)c1cccc(N)c1C
methyl 2-methyl-3-aminobenzoate
수율 101.6%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타at room temperature
  2. 2
    여과the catalyst is filtered off
  3. 3
    농축The reaction mixture is concentrated
  4. 4
    workup.ADDITIONis added water
  5. 5
    추출followed by extraction with dichloromethane
  6. 6
    농축The solvent is concentrated

실험 절차

Methyl 2-methyl-3-nitrobenzoate (10.0 g) is dissolved in acetic acid (50 ml) and thereto 5% Pd-C (1 g) is added to carry out catalytic reduction at room temperature under 1 atm. After 1.5 hours, the catalyst is filtered off. The reaction mixture is concentrated, and thereto is added water, and the mixture is made alkaline with potassium carbonate, followed by extraction with dichloromethane. The solvent is concentrated to give methyl 2-methyl-3-aminobenzoate (8.6 g).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05723648uspto-grants-1998_03