반응 #1379892

ord-423113c6f9214254b81f248800c52937

반응 방정식

CC(C)(C)OC(=O)NCC(NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1
2,3-bis-tert-butoxycarbonylamino propionic acid benzyl ester
Cl
HCl
Cl.Cl.Cl.NCC(N)C(=O)O
2,3-Diamino-propionic acid trihydrochloride

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타The solvent was removed under vacuum
  2. 2
    workup.ADDITIONthe mixture was diluted with ethyl acetate (100 ml) and water (50 ml)
  3. 3
    기타The layers were separated
  4. 4
    기타the aqueous layer was evaporated to dryness (1.23 g of a foam/syrup)

실험 절차

A solution of 2,3-bis-tert-butoxycarbonylamino propionic acid benzyl ester (1.8 g), 4N aqueous HCl (40 ml), and acetonitrile (50 ml) was stirred for 18 hours at room temperature. The solvent was removed under vacuum, and the mixture was diluted with ethyl acetate (100 ml) and water (50 ml) and stirred for 15 minutes. The layers were separated and the aqueous layer was evaporated to dryness (1.23 g of a foam/syrup). 1H NMR (300 MHz): 3.2-3.5 (m, 2H), 4.2-4.35 (m, 1H), 5.13-5.25 (q, 2H, J=11.8, 3.1 Hz).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07238341B2uspto-grants-2007_07