반응 #1365693

ord-7bde0c4246754fdbb8b6f6b0c147fc67

반응 방정식

O=C(O)CC(O)(CC(=O)O)C(=O)O
citric acid
O.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[K+].[K+].[K+]
potassium citrate monohydrate
O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[K+].[K+].[K+]
potassium citrate
O=C(O)CC(O)(CC(=O)O)C(=O)O
citric acid

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타In one illustrative embodiment, the pre-polish cleaner is formed

실험 절차

In one embodiment, the pre-polish cleaner is formed from citric acid and potassium citrate, and has a pH in the lower end of the above-described range; more particularly it has a pH in the range of 2.5 to 4. In one illustrative embodiment, the pre-polish cleaner is formed by combining, with water, 40 g/l of anhydrous citric acid and 40 g/l of potassium citrate monohydrate. In other embodiments of the present invention, the cleaning solution is formed from a combination of citric acid and potassium citrate wherein the amount of citric acid is in the range of 0 to 40 g/l and the amount of potassium citrate is in the range of 0 to 40 g/l, and wherein the total number of g/l is greater than 0.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06443814B1uspto-grants-2002_09