반응 #1352

ord-54b03352f0df47deb65aac6e35fc4ae0

반응 방정식

CCC(Cc1ccccc1-c1ccccc1)C(=O)O
3-(2-biphenylyl)-2-ethylpropionic acid
O=S(Cl)Cl
thionyl chloride
CCC(Cc1ccccc1-c1ccccc1)C(=O)Cl
crude product
수율 106.3%
CCC(Cc1ccccc1-c1ccccc1)C(=O)Cl
3-(2-biphenylyl)-2-ethylpropionyl chloride
수율 106.3%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타A 100-ml three-necked round flask equipped with a stirring bar
  2. 2
    온도under reflux for 2.5 hours under a nitrogen atmosphere
  3. 3
    workup.DISTILLATIONthe unreacted thionyl chloride was distilled off under reduced pressure

실험 절차

A 100-ml three-necked round flask equipped with a stirring bar, a Dimroth condenser, a thermometer and a NaOH trap was charged with 13.3 g (52.4 mmol) of 3-(2-biphenylyl)-2-ethylpropionic acid and 25.9 ml (355 mmol) of thionyl chloride, and the resulting mixture was stirred under reflux for 2.5 hours under a nitrogen atmosphere. After the reaction was completed, the unreacted thionyl chloride was distilled off under reduced pressure to obtain 15.2 g of a crude product as a yellow-orange liquid. The thus obtained acid chloride was used in the next reaction without further purification.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05723640uspto-grants-1998_03