반응 #1328402

ord-94a152ad47834b769041e85313c6e34f

반응 방정식

CC[C@@H](C[C@H](O)[C@@H](C)N(Cc1ccccc1)Cc1ccccc1)c1ccccc1
N,N-dibenzyl-(1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine
CC(=O)O
acetic acid
CC[C@@H](C[C@H](O)[C@@H](C)N)c1ccccc1
(1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine
수율 78.5%

용매

반응 조건

온도
50°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    여과the catalyst was filtered off
  2. 2
    기타The liquid filtrate thus obtained
  3. 3
    농축was concentrated under reduced pressure
  4. 4
    workup.ADDITIONTo the resulting residue, a saturated sodium hydrogen carbonate aqueous solution (15 ml) was added
  5. 5
    추출two 50 ml methylene chloride extractions
  6. 6
    건조The resulting organic layer was dried with anhydrous magnesium sulfate
  7. 7
    여과Magnesium sulfate was filtered off
  8. 8
    농축the liquid filtrate was concentrated under reduced pressure

실험 절차

The N,N-dibenzyl-(1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine (1.46 g, 3.77 mmol) obtained above was dissolved in methanol (25 ml). Subsequently, acetic acid (0.43 ml, 7.53 mmol) and 5% Pd-C (palladium carbon; containing 50% of water) (0.6 g) were added to the dissolved solution. This reaction solution was stirred for 16 hours at 50° C. under a hydrogen atmosphere, and the catalyst was filtered off. The liquid filtrate thus obtained was concentrated under reduced pressure. To the resulting residue, a saturated sodium hydrogen carbonate aqueous solution (15 ml) was added and two 50 ml methylene chloride extractions were performed. The resulting organic layer was dried with anhydrous magnesium sulfate. Magnesium sulfate was filtered off and the liquid filtrate was concentrated under reduced pressure to yield (1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine (0.61 g, 2.96 mmol).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07115296B2uspto-grants-2006_10