반응 #1121717

ord-6443f120eee842b89ebc7183e3ed6996

반응 방정식

[Cl-].[NH4+]
ammonium chloride
O=S(Cl)Cl
thionyl chloride
C=CC(=O)OCCCCCCOc1ccc(C(=O)O)cc1
4-{[6-(acryloyloxy)hexyl]oxy}benzoic acid
Oc1ccc(OCCCCCCBr)cc1
4-(6-bromohexyloxy)phenol
C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCCBr)cc2)cc1
4-(6-bromo hexyloxy)phenyl 4-{[6-(acryloyloxy)hexyl]oxy}benzoate
수율 59.9%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타was adjusted to a temperature of 0° C. (Celsius)
  2. 2
    workup.STIRRINGstirred at 0° C. (Celsius) for 1 hour
  3. 3
    workup.STIRRINGstirred at a room temperature overnight
  4. 4
    기타The resulting reaction mixture
  5. 5
    추출was extracted three times with ethyl acetate (50 ml (milliliters)), and waster
  6. 6
    기타was removed over magnesium sulfate
  7. 7
    기타Then, the solvents were evaporated
  8. 8
    기타the resulting reaction mixture
  9. 9
    기타was then purified

실험 절차

4-{[6-(acryloyloxy)hexyl]oxy}benzoic acid (4) (2.8 g (grams)) was dissolved in tetrahydrofurane (THF, 100 ml (milliliters)) at a room temperature, and a temperature of the resulting mixture was adjusted to a temperature of 0° C. (Celsius). Then, thionyl chloride (12 ml (milliliters), 1M in THF) was added to the mixture, and stirred for 30 minutes. Then, 4-(6-bromohexyloxy)phenol (2.5 g (grams)) and triethyl amine (13 ml (milliliters)) were added to the resulting reaction mixture, stirred at 0° C. (Celsius) for 1 hour, and then stirred at a room temperature overnight. Next day, a saturated ammonium chloride aqueous solution was poured into the reaction mixture, and the reaction was completed. The resulting reaction mixture was extracted three times with ethyl acetate (50 ml (milliliters)), and waster was removed over magnesium sulfate. Then, the solvents were evaporated, and the resulting reaction mixture was then purified using a column chromatography (developer solution: ethylacetate/hexane=1/2 volume ratio) to obtain 4-(6-bromo hexyloxy)phenyl 4-{[6-(acryloyloxy)hexyl]oxy}benzoate (5) (3 g (grams)).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08545717B2uspto-grants-2013_10