반응 #1106618

ord-a7f65cb968e443f0a7c1f173ccda8d4e

반응 방정식

CCCCCC[n+]1ccn(C)c1.[Cl-]
1-Hexyl-3-methylimidazolium chloride
O=S(=O)([O-])C(F)(F)C(F)F.[K+]
Potassium 1,1,2,2-tetrafluoroethane sulfonate
CC(C)=O.CCCCCC[n+]1ccn(C)c1.[Cl-]
1-hexyl-3-methylimidazolium chloride acetone
CCCCCC[n+]1ccn(C)c1.O=S(=O)([O-])C(F)(F)C(F)F
1-hexyl-3-methylimidazolium 1,1,2,2-tetrafluoroethanesulfonate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.WAITThe mixture was left
  2. 2
    workup.STIRRINGto stir overnight
  3. 3
    여과The reaction mixture was then filtered
  4. 4
    기타to remove the white KCl precipitate
  5. 5
    기타formed
  6. 6
    기타the filtrate was placed on a rotary evaporator for 4 hours
  7. 7
    기타to remove the acetone

실험 절차

1-Hexyl-3-methylimidazolium chloride (10 g, 0.0493 moles) was mixed with reagent-grade acetone (100 ml) in a large round-bottomed flask and stirred vigorously under a nitrogen blanket. Potassium 1,1,2,2-tetrafluoroethane sulfonate (TFES-K, 10 g, 0.0455 moles) was added to reagent grade acetone (100 ml) in a separate round-bottomed flask, and this solution was carefully added to the 1-hexyl-3-methylimidazolium chloride/acetone mixture. The mixture was left to stir overnight. The reaction mixture was then filtered using a large frit glass funnel to remove the white KCl precipitate formed, and the filtrate was placed on a rotary evaporator for 4 hours to remove the acetone.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08715521B2uspto-grants-2014_05