반응 #1076045

ord-4637cb414d054494a394713a73ebbfa6

반응 방정식

[Na+].c1cc[cH-]c1
sodium cyclopentadienide
CC(C)(C)N[Si](C)(C)CBr
2-bromo-1-tertbutylamino-1,1-dimethylsilaethane
CC(C)(C)N[Si](C)(C)CC1C=CC=C1
1-tertbutylamino-2-cyclopentadienyl-1,1-dimethylsilaethane
수율 80.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    농축it was concentrated to dryness and it
  2. 2
    추출was extracted with hexane
  3. 3
    기타the resulting solution was evaporated in order
  4. 4
    기타to give a yellow oil
  5. 5
    workup.ADDITIONthat corresponds to a mixture of isomers (12.5 g, 60 mmol, yield: 80%)

실험 절차

32.7 ml of a 2.3 M solution (75 mmol) of sodium cyclopentadienide in tetrahydrofurane was added to a solution of 11.4 g (51 mmol) of 2-bromo-1-tertbutylamino-1,1-dimethylsilaethane. The immediate formation of a pinkish solid was observed, the reaction was continued for 8 hours, then it was concentrated to dryness and it was extracted with hexane, the resulting solution was evaporated in order to give a yellow oil, that corresponds to a mixture of isomers (12.5 g, 60 mmol, yield: 80%). 1H-NMR (CDCl3): 6.5-5.75(m,3H), 2.95(m,2H), 1.90(m,2H), 1.20(s,9H), 0.10(s,6H).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06635778B1uspto-grants-2003_10