반응 #10650

반응 방정식

Intermediate 92

N-(tert-butoxycarbonyl)-N′-(4-chloro-5-isoquinolyl)-1,4-cyclohexanediamine

hydrogen chloride methanol

→

title compound

N-(4-chloro-5-isoquinolyl)-1,4-cyclohexanediamine hydrochloride

반응 조건

후처리

1. 1
   기타(room temperature, 2 hours)
2. 2
   기타The solvent was evaporated under reduced pressure
3. 3
   workup.ADDITIONthe residue was added with methanol (1 ml) and diethyl ether (3 ml)
4. 4
   기타The deposited precipitates
5. 5
   여과were collected by filtration
6. 6
   세척washed with diethyl ether

실험 절차

According to the method of Example 1, Step C, deprotection was performed (room temperature, 2 hours) by using Intermediate 92 (40.4 mg) and 10% hydrogen chloride/methanol solution (2 ml). The solvent was evaporated under reduced pressure, and the residue was added with methanol (1 ml) and diethyl ether (3 ml). The deposited precipitates were collected by filtration and washed with diethyl ether to obtain the title compound (37.8 mg) as light yellow powdery solid.

출처