Réaction #710498

ord-d11eef648f3645f785f27b249355fa45

Équation de réaction

O=C(O)c1ccc(C(F)(F)F)nc1Cl
2-chloro-6-(trifluoromethyl)nicotinic acid
B.C1CCOC1
BH3-THF
OCc1ccc(C(F)(F)F)nc1Cl
[2-chloro-6-(trifluoromethyl)pyridin-3-yl]methanol

Solvants

Conditions de réaction

Conditions détaillées
See reaction.notes.procedure_details.

Traitement

  1. 1
    ConcentrationAfter 16 h the reaction mixture was concentrated under reduced pressure
  2. 2
    Autreto remove THF
  3. 3
    AutreThe resulting reaction mixture
  4. 4
    Extractionextracted with ethyl acetate (2×500 mL)
  5. 5
    LavageThe combined organic layers were washed with water (500 mL), brine (500 mL)
  6. 6
    Séchagedried over anhydrous sodium sulfate
  7. 7
    Autrethe solvent was removed under reduced pressure

Mode opératoire

To a stirred solution of e 2-chloro-6-(trifluoromethyl)nicotinic acid (Int-15) (40 g, 1.0 eq.) in THF (400 mL) was added BH3-THF (266.6 mL, 1.5 eq) at room temperature. The progress of the reaction was monitored by TLC. After 16 h the reaction mixture was concentrated under reduced pressure to remove THF. The resulting reaction mixture was diluted with 10% NaHCO3 (500 mL) and extracted with ethyl acetate (2×500 mL). The combined organic layers were washed with water (500 mL), brine (500 mL), dried over anhydrous sodium sulfate and the solvent was removed under reduced pressure to get crude [2-chloro-6-(trifluoromethyl)pyridin-3-yl]methanol (Int-16) as light yellow liquid, 32 g (85.5%).

Source

DOI: 10.6084/m9.figshare.5104873.v1Brevet: US09301526B2uspto-grants-2016_04