Réaction #2006397

ord-1db473ffa9474d29904f6cbcb238cb24

Équation de réaction

COC(=O)Cl
methyl chloroformate
N[C@H](C(=O)O)C1CCOCC1
(S)-2-amino-2-(tetrahydro-2H-pyran-4-yl)acetic acid
O=C([O-])[O-].[Na+].[Na+]
sodium carbonate
COC(=O)N[C@H](C(=O)O)C1CCOCC1
(S)-2-(methoxycarbonylamino)-2-(tetrahydro-2H-pyran-4-yl)acetic acid

Solvants

Conditions de réaction

Conditions détaillées
See reaction.notes.procedure_details.

Traitement

  1. 1
    Autrethaw to ambient temperature
  2. 2
    AutreThe reaction mixture was then partitioned between 1N HCl and ethyl acetate
  3. 3
    AutreThe organic layer was removed
  4. 4
    Extractionthe aqueous layer was further extracted with 2 additional portions of ethyl acetate
  5. 5
    LavageThe combined organic layers were washed with brine
  6. 6
    Séchagedried over magnesium sulfate
  7. 7
    Filtrationfiltered
  8. 8
    Concentrationconcentrated in vacuo
  9. 9
    Autreto afford Cap-170 a colorless residue

Mode opératoire

To (S)-2-amino-2-(tetrahydro-2H-pyran-4-yl)acetic acid (505 mg; 3.18 mmol; obtained from Astatech) in water (15 ml) was added sodium carbonate (673 mg; 6.35 mmol), and the resultant mixture was cooled to 0° C. and then methyl chloroformate (0.26 ml; 3.33 mmol) was added dropwise over 5 minutes. The reaction was allowed to stir for 18 hours while allowing the bath to thaw to ambient temperature. The reaction mixture was then partitioned between 1N HCl and ethyl acetate. The organic layer was removed and the aqueous layer was further extracted with 2 additional portions of ethyl acetate. The combined organic layers were washed with brine, dried over magnesium sulfate, filtered and concentrated in vacuo to afford Cap-170 a colorless residue. 1H NMR (500 MHz, DMSO-d6) δ ppm 12.65 (1H, br s), 7.44 (1H, d, J=8.24 Hz), 3.77-3.95 (3H, m), 3.54 (3H, s), 3.11-3.26 (2H, m), 1.82-1.95 (1H, m), 1.41-1.55 (2H, m), 1.21-1.39 (2H, m); LC/MS: Anal. Calcd. for [M+H]+ C9H16NO5: 218.1. Found 218.1.

Source

DOI: 10.6084/m9.figshare.5104873.v1Brevet: US08618153B2uspto-grants-2013_12