Réaction #1702048

ord-2652b915713a485b932df9e5bffba0be

Équation de réaction

CCOC(=O)COc1ccc([C@@H]2CCC(=O)C2)cc1
(R)-[4-(3-Oxo-cyclopentyl)-phenoxy]-acetic acid ethyl ester
O=C(O)COc1ccc([C@@H]2CCC(=O)C2)cc1
title compound
Rendement 89.0%
O=C(O)COc1ccc([C@@H]2CCC(=O)C2)cc1
(R)-[4-(3-Oxo-cyclopentyl)-phenoxy]-acetic acid
Rendement 89.0%

Solvants

Conditions de réaction

Conditions détaillées
See reaction.notes.procedure_details.

Traitement

  1. 1
    AutreThen the EtOH was evaporated
  2. 2
    workup.ADDITIONthe reaction mixture diluted with water
  3. 3
    Extractionextracted with DCM
  4. 4
    SéchageDried over Na2SO4
  5. 5
    Concentrationconcentrated in vacuo

Mode opératoire

(R)-[4-(3-Oxo-cyclopentyl)-phenoxy]-acetic acid ethyl ester (preparation 30) (6.0 mmol, 1.57 g) was taken up in EtOH (6 mL) and NaOH (2N, 6 mL), the reaction mixture stirred at r.t. for 2 h. Then the EtOH was evaporated and the reaction mixture diluted with water, then neutralized with HCl (2N) to pH 5 and extracted with DCM. Dried over Na2SO4 and concentrated in vacuo to yield the title compound (1.24 g, 89%). 1H NMR (300 MHz, CDCl3) δ 7.23-7.06 (m, 2H), 6.98-6.72 (m, 2H), 4.66 (s, 2H), 3.53-3.13 (m, 1H), 2.64 (dd, J=7.5, 18.2, 1H), 2.56-2.17 (m, 4H), 2.14-1.69 (m, 1H).

Source

DOI: 10.6084/m9.figshare.5104873.v1Brevet: US08765676B2uspto-grants-2014_07