Réaction #1702024

ord-a0e4f3e74c53462898db953c8a49c170

Équation de réaction

O=C(O)c1cccc(C(=O)O)c1
isophthalic acid
Nc1ccccc1O
aminophenol
O=C(O)c1ccc2cc(O)ccc2c1
2-hydroxy-6-naphthoic acid
CC(=O)OC(C)=O
acetic anhydride
O=C1C=CC(=O)N1
maleimide
O=C(O)c1ccccc1N1C(=O)C=CC1=O
maleimidobenzoic acid
O=C(O)c1ccccc1
benzoic acid
C#C.O=C(O)c1ccccc1
acetylene benzoic acid

Conditions de réaction

Température
320°CELSIUS
Conditions détaillées
See reaction.notes.procedure_details.

Traitement

  1. 1
    AutreAlternatively, the liquid crystalline thermoset oligomer can be prepared by a bulk polymerization process in accordance with the following procedure
  2. 2
    Températureto reflux for a predetermined time period
  3. 3
    AutreAcetic acid as a by-product and unreacted acetic anhydride are removed from the reaction mixture
  4. 4
    workup.ADDITIONNext, 4-hydroxybenzoic acid is added
  5. 5
    Températurethe reaction temperature is maintained which
  6. 6
    Autrethe reaction
  7. 7
    Autreto give a liquid crystal oligomer

Mode opératoire

Alternatively, the liquid crystalline thermoset oligomer can be prepared by a bulk polymerization process in accordance with the following procedure. In another exemplary method, isophthalic acid, aminophenol, 2-hydroxy-6-naphthoic acid and acetic anhydride are slowly heated to 150° C. with stirring in a reactor. The mixture is brought to reflux for a predetermined time period. Acetic acid as a by-product and unreacted acetic anhydride are removed from the reaction mixture. Next, 4-hydroxybenzoic acid is added, and the temperature is further raised to 320° C. and the reaction temperature is maintained which allows the reaction to proceed, to give a liquid crystal oligomer having one or two terminal alcohol groups at one or both ends of the backbone. The liquid crystal oligomer is dissolved in a proper solvent (e.g., N,N-dimethylformamide, abbreviated “DMF”), and then a compound (e.g., maleimidobenzoic acid, nadimide benzoic acid, or acetylene benzoic acid) capable of providing thermally crosslinkable reactive groups (e.g., maleimide, nadimide or acetylene groups) is added to the solution. The mixture is allowed to react to give the liquid crystalline thermoset oligomer having one or two thermally crosslinkable reactive groups at one or both ends of the backbone thereof.

Source

DOI: 10.6084/m9.figshare.5104873.v1Brevet: US08765012B2uspto-grants-2014_07