Reacción #91537

ord-7ea6cee5f3424b6fb98a34f4aec33926

Ecuación de reacción

Oc1ccc(C(F)(F)C2(c3ccc(F)cc3F)CO2)nc1
6-((2-(2,4-difluorophenyl)oxiran-2-yl)difluoromethyl)pyridin-3-ol
O=C([O-])[O-].[K+].[K+]
K2CO3
O=S(=O)(OCC(F)(F)F)C(F)(F)F
2,2,2-trifluoroethyl trifluoromethanesulfonate
Fc1ccc(C2(C(F)(F)c3ccc(OCC(F)(F)F)cn3)CO2)c(F)c1
2-((2-(2,4-difluorophenyl)oxiran-2-yl)difluoromethyl)-5-(2,2,2-trifluoroethoxy)pyridine

Disolventes

Condiciones de reacción

Temperatura
25°CELSIUS
Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    OtroThe reaction was quenched with MeOH (2 mL)
  2. 2
    Otrovolatiles were removed under a gentle stream of N2
  3. 3
    OtroThe resulting residue was partitioned with water and CH2Cl2
  4. 4
    Otrothe organic layer was removed
  5. 5
    LavadoThe aqueous layer was washed CH2Cl2 (2×)
  6. 6
    Otrowere dried
  7. 7
    OtroVolatiles were removed under a gentle stream of N2
  8. 8
    Otrothe crude orange oil was carried on without further purification (779 mg, 97%)

Procedimiento

To a magnetically stirred mixture of 6-((2-(2,4-difluorophenyl)oxiran-2-yl)difluoromethyl)pyridin-3-ol (600 mg, 2.005 mmol) and K2CO3 (305 mg, 2.206 mmol) in acetone (6.76 mL) was added 2,2,2-trifluoroethyl trifluoromethanesulfonate (558 mg, 2.406 mmol) in a 20 mL vial under an atmosphere of air. The reaction mixture was stirred at 25° C. for 16 h. As the reaction progressed the reaction mixture became a cloudy beige suspension. The reaction was quenched with MeOH (2 mL) and then volatiles were removed under a gentle stream of N2. The resulting residue was partitioned with water and CH2Cl2 and the organic layer was removed. The aqueous layer was washed CH2Cl2 (2×) and combined organic layers were dried by passing through a phase separator. Volatiles were removed under a gentle stream of N2 and the crude orange oil was carried on without further purification (779 mg, 97%): 1H NMR (400 MHz, CDCl3) δ 8.40 (d, J=2.9 Hz, 1H), 7.46 (d, J=8.7 Hz, 1H), 7.38 (dd, J=14.7, 8.2 Hz, 1H), 7.28 (d, J=2.9 Hz, 1H), 6.88-6.80 (m, 1H), 6.78-6.71 (m, 1H), 4.44 (q, J=7.9 Hz, 2H), 3.43 (d, J=5.1 Hz, 1H), 3.00-2.95 (m, 1H); 19F NMR (376 MHz, CDCl3) δ −73.75 (s, 3F), −107.01 (dd, J=257.0, 8.5 Hz, 1F), −107.55-−108.43 (m, 2F), −109.41 (q, J=8.5 Hz, 1F). ESIMS m/z 382 ([M+H]+).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US09447073B2uspto-grants-2016_09