Reacción #8526

ord-df2cd1af74594089ac13ed08c39f07ae

Ecuación de reacción

[H][H]
hydrogen
O=[N+]([O-])c1ccc(F)c(F)c1F
2,3, 4-Trifluoronitrobenzene
COC(=O)C(C)=O
methyl pyruvate
O=S(=O)([O-])[O-].[Mg+2]
magnesium sulfate
COC(=O)C(C)Nc1ccc(F)c(F)c1F
title compound
Rendimiento 97.4%
COC(=O)C(C)Nc1ccc(F)c(F)c1F
Methyl 2-(2,3,4-trifluoroanilino)propionate
Rendimiento 97.4%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    OtroThen the liquid reaction mixture
  2. 2
    Filtraciónwas filtered through celite
  3. 3
    ConcentraciónThe obtained filtrate was concentrated under reduced pressure and Florisil (100 g) and diethyl ether (700 ml)
  4. 4
    workup.ADDITIONwere added to the residue
  5. 5
    Otrothe liquid reaction mixture
  6. 6
    Filtraciónwas filtered
  7. 7
    OtroThe obtained organic layer was evaporated
  8. 8
    Otrothe crystals thus precipitated
  9. 9
    Filtraciónwere filtered
  10. 10
    Lavadowhile washing with hexane

Procedimiento

2,3, 4-Trifluoronitrobenzene (100 g) and methyl pyruvate (57.6 g) were dissolved in methanol (1000 ml). After adding 5% Pd—C (20.0 g) and anhydrous magnesium sulfate (90 g), the mixture was stirred at room temperature in a hydrogen atmosphere for 16 hours. Then the liquid reaction mixture was filtered through celite to thereby eliminate Pd—C and magnesium sulfate. The obtained filtrate was concentrated under reduced pressure and Florisil (100 g) and diethyl ether (700 ml) were added to the residue. After stirring for 2 hours, the liquid reaction mixture was filtered. The obtained organic layer was evaporated and the crystals thus precipitated were filtered while washing with hexane. Thus the title compound (128.2 g) was obtained as slightly yellowish crystals.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US07087778B2uspto-grants-2006_08