Reacción #84296

ord-d0c9b7946e174fe78f9564fb0b5e5355

Ecuación de reacción

O
water
CC(C)(C)OC(=O)NCC(=NO)c1ncc(Cl)cc1Cl
tert-butyl N-[2-(3,5-dichloropyridin-2-yl)-2-(hydroxyimino)ethyl]carbamate
O=C([O-])[O-].[K+].[K+]
potassium carbonate
O=S(=O)(OCC(F)(F)F)C(F)(F)F
2,2,2-trifluoroethyl trifluoromethanesulfonate
CC(C)(C)OC(=O)NCC(=NOCC(F)(F)F)c1ncc(Cl)cc1Cl
desired product
Rendimiento 76.4%
CC(C)(C)OC(=O)NCC(=NOCC(F)(F)F)c1ncc(Cl)cc1Cl
tert-butyl N-[2-(3,5-dichloropyridin-2-yl)-2-(2,2,2-trifluoroethoxyimino)ethyl]carbamate
Rendimiento 76.4%

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    OtroAfter completion of the reaction
  2. 2
    Extracciónextracted with ethyl acetate (100 ml×2)
  3. 3
    Lavadowashed with water (50 ml×2)
  4. 4
    Secadodried over saturated aqueous sodium chloride
  5. 5
    Otroanhydrous sodium sulfate, and the solvent was evaporated under reduced pressure
  6. 6
    OtroThe resulting residue was purified by silica gel column chromatography

Procedimiento

To 5.0 g of tert-butyl N-[2-(3,5-dichloropyridin-2-yl)-2-(hydroxyimino)ethyl]carbamate in 16.0 ml of N,N-dimethylformamide, 4.3 g of potassium carbonate and 5.4 g of 2,2,2-trifluoroethyl trifluoromethanesulfonate were added, and the mixture was stirred at room temperature for 18 hours. After completion of the reaction, the reaction mixture was mixed with 100 ml of water and extracted with ethyl acetate (100 ml×2), the resulting organic layers were combined, washed with water (50 ml×2) and dried over saturated aqueous sodium chloride and then anhydrous sodium sulfate, and the solvent was evaporated under reduced pressure. The resulting residue was purified by silica gel column chromatography using ethyl acetate-hexane (with a gradient of from 0:10 to 3:7) as the eluent to obtain 4.8 g of the desired product as a pale yellow oil.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US09434684B2uspto-grants-2016_09