Reacción #5492

ord-6d7f78a9e4854515844933e38954e2d1

Ecuación de reacción

CC(=O)SC[C@H]1CCCCCC[C@H](C(=O)O)NC1=O
Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid
CN1CCOCC1
4-Methylmorpholine
CCOC(=O)Cl
Ethyl chloroformate
CC(=O)SC[C@H]1CCCCCC[C@H](C(N)=O)NC1=O
trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxamide

Condiciones de reacción

Temperatura
-20°CELSIUS
Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    FiltraciónThe reaction is then filtered
  2. 2
    Concentraciónthe filtrate is concentrated
  3. 3
    Otroto give a yellow oil
  4. 4
    Otroanhydrous ammonia gas is bubbled through the solution for 1 hour
  5. 5
    workup.STIRRINGthe reaction is stirred an additional 1 hour
  6. 6
    OtroThe solvent is evaporated
  7. 7
    Otrothe residue is partitioned between ethyl acetate and water
  8. 8
    ExtracciónThe aqueous layer is extracted several times with ethyl acetate
  9. 9
    Secadothe combined organic layers are dried (Na2SO4)
  10. 10
    Otrothe solvent is evaporated

Procedimiento

Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid (0.30 g, 1.05 mmol) is dissolved in tetrahydrofuran (5.0 mL). 4-Methylmorpholine (0.14 mL, 1.05 mmol) is then added, and the reaction is cooled to -20° C. Ethyl chloroformate (0.1 mL, 1.05 mmol) is then added, and the reaction is stirred at -20° C. for 30 minutes. The reaction is then filtered, and the filtrate is concentrated to give a yellow oil. This oil is dissolved in methylene chloride (20.0 mL), and anhydrous ammonia gas is bubbled through the solution for 1 hour. The bubbling is stopped, and the reaction is stirred an additional 1 hour. The solvent is evaporated, and the residue is partitioned between ethyl acetate and water. The aqueous layer is extracted several times with ethyl acetate, the combined organic layers are dried (Na2SO4), and the solvent is evaporated to give trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxamide, MS:M+1=287.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US05244889uspto-grants-1993_09