Reacción #536927

ord-744660de7a06430eab6319ed41fe7992

Ecuación de reacción

[Na+].[OH-]
sodium hydroxide
CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(C#N)cc1)n2C)c1ccccn1
3-({2-[(4-Cyano-phenylamino)-methyl]-1-methyl-1H-benzoimidazole-5-carbonyl}-pyridin-2-yl-amino)-propionic acid ethyl ester
Cn1c(CNc2ccc(C#N)cc2)nc2cc(C(=O)N(CCC(=O)O)c3ccccn3)ccc21
3-({2-[(4-Cyano-phenylamino)-methyl]-1-methyl-1H-benzoimidazole-5-carbonyl}-pyridin-2-yl-amino)-propionic acid

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    workup.DISTILLATIONca. 350 mL ethanol were distilled off
  2. 2
    workup.ADDITIONca. 100 mL water was added
  3. 3
    workup.ADDITIONThen diethylether (50 mL) was added
  4. 4
    workup.STIRRINGthe mixture stirred over night
  5. 5
    OtroThe product was isolated by filtration
  6. 6
    Otroused without further purification

Procedimiento

To a solution of sodium hydroxide (50.0 mmol) in 500 mL ethanol and 50 mL water was added 3-({2-[(4-Cyano-phenylamino)-methyl]-1-methyl-1H-benzoimidazole-5-carbonyl}-pyridin-2-yl-amino)-propionic acid ethyl ester (41.4 mmol). The mixture was stirred at room temperature for three hours, then ca. 350 mL ethanol were distilled off, ca. 100 mL water was added and the pH was adjusted to 6. Then diethylether (50 mL) was added and the mixture stirred over night. The product was isolated by filtration and used without further purification.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08486398B2uspto-grants-2013_07