Reacción #51609

ord-b6e11d698b0b4e43a46330c8a8509f06

Ecuación de reacción

C[O-].[Na+]
sodium methoxide
CC(=O)c1ccc(OCc2ccccc2)c(C)c1O
1-[2-hydroxy-3-methyl-4-(phenylmethoxy)phenyl]-ethanone
CCOC(=O)C(=O)OCC
ethanedioic acid, diethyl ester
Cc1c(OCc2ccccc2)ccc2c(=O)cc(C(=O)O)oc12
8-methyl-4-oxo-7-(phenylmethoxy)-4H-1-benzopyran-2-carboxylic acid
Rendimiento 95.4%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Temperaturarefluxed for 2 hours
  2. 2
    OtroThe solvent was evaporated
  3. 3
    workup.ADDITIONThe residue was added to a mixture of acetic acid (150 ml) and hydrochloric acid (50 ml)
  4. 4
    workup.STIRRINGThe reaction mixture was stirred
  5. 5
    Temperaturarefluxed for 1 hour
  6. 6
    workup.ADDITIONThe mixture was poured out onto ice
  7. 7
    FiltraciónThe resulting precipitate was filtered off
  8. 8
    Otrodried (vacuum; 70° C.)

Procedimiento

A mixture of 1-[2-hydroxy-3-methyl-4-(phenylmethoxy)phenyl]-ethanone (0.098 mol) and ethanedioic acid, diethyl ester (0.11 mol) in toluene (100 ml) was added dropwise to a mixture of sodium methoxide (0.22 mol) in toluene (150 ml). The reaction mixture was stirred and refluxed for 2 hours. The solvent was evaporated. The residue was added to a mixture of acetic acid (150 ml) and hydrochloric acid (50 ml). The reaction mixture was stirred and refluxed for 1 hour. The mixture was poured out onto ice. The resulting precipitate was filtered off and dried (vacuum; 70° C.), yielding 29 g (95.4%) of 8-methyl-4-oxo-7-(phenylmethoxy)-4H-1-benzopyran-2-carboxylic acid (interm. 9).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US06852714B2uspto-grants-2005_02